C23H15F3N4O3 — CID 171750583
N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-6-fluoro-4-isocyano-N-methyl-1H-indole-2-carboxamide (PubChem CID 171750583) has the molecular formula C23H15F3N4O3 and a molecular weight of 452.39 g/mol. Its IUPAC name is N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-6-fluoro-4-isocyano-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-6-fluoro-4-isocyano-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 171750583 |
| Molecular Formula | C23H15F3N4O3 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-6-fluoro-4-isocyano-N-methyl-1H-indole-2-carboxamide |
| SMILES | [C-]#[N+]c1cc(F)cc2[nH]c(C(=O)N(C)[C@@H]3COCc4[nH]c(=O)c5cc(F)c(F)cc5c43)cc12 |
| InChI | InChI=1S/C23H15F3N4O3/c1-27-16-3-10(24)4-17-13(16)7-18(28-17)23(32)30(2)20-9-33-8-19-21(20)11-5-14(25)15(26)6-12(11)22(31)29-19/h3-7,20,28H,8-9H2,2H3,(H,29,31)/t20-/m1/s1 |
| InChIKey | LIZDLNUIQZMSIU-HXUWFJFHSA-N |
| XLogP | 4.32 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|