C46H56N2O — CID 171750673
3,5-bis(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenol (PubChem CID 171750673) has the molecular formula C46H56N2O and a molecular weight of 652.97 g/mol. Its IUPAC name is 3,5-bis(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenol.
| Compound Name | 3,5-bis(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenol |
|---|---|
| PubChem CID | 171750673 |
| Molecular Formula | C46H56N2O |
| Molecular Weight | 652.97 g/mol |
| Exact Mass | 652.44 |
| IUPAC Name | 3,5-bis(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenol |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(O)cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C46H56N2O/c1-43(2,3)32-13-21-36(22-14-32)47(37-23-15-33(16-24-37)44(4,5)6)40-29-41(31-42(49)30-40)48(38-25-17-34(18-26-38)45(7,8)9)39-27-19-35(20-28-39)46(10,11)12/h13-31,49H,1-12H3 |
| InChIKey | UPRAMRHLYMIYGL-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.97 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |