C20H20N8O5 — CID 171750960
N-[7-[(2R,3R,4S,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-4-(diaminomethylideneamino)benzamide (PubChem CID 171750960) has the molecular formula C20H20N8O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is N-[7-[(2R,3R,4S,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-4-(diaminomethylideneamino)benzamide.
| Compound Name | N-[7-[(2R,3R,4S,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-4-(diaminomethylideneamino)benzamide |
|---|---|
| PubChem CID | 171750960 |
| Molecular Formula | C20H20N8O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[7-[(2R,3R,4S,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-4-(diaminomethylideneamino)benzamide |
| SMILES | N#C[C@@]1(c2ccc3c(NC(=O)c4ccc(N=C(N)N)cc4)ncnn23)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20N8O5/c21-8-20(16(31)15(30)13(7-29)33-20)14-6-5-12-17(24-9-25-28(12)14)27-18(32)10-1-3-11(4-2-10)26-19(22)23/h1-6,9,13,15-16,29-31H,7H2,(H4,22,23,26)(H,24,25,27,32)/t13-,15-,16-,20+/m1/s1 |
| InChIKey | JWFKMTSCIZNZAE-CQNRTFJUSA-N |
| XLogP | -1.28 |
| TPSA | 217.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|