C9H8F13NO — CID 171752158
3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)propan-1-amine (PubChem CID 171752158) has the molecular formula C9H8F13NO and a molecular weight of 393.14 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)propan-1-amine.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)propan-1-amine |
|---|---|
| PubChem CID | 171752158 |
| Molecular Formula | C9H8F13NO |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)propan-1-amine |
| SMILES | NCCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F13NO/c10-4(11,6(14,15)8(18,19)20)5(12,13)7(16,17)9(21,22)24-3-1-2-23/h1-3,23H2 |
| InChIKey | VIDBRVBXHUYELW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|