C20H23N3O5S — CID 17175247
methyl 3-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamoyl]benzoate (PubChem CID 17175247) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is methyl 3-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamoyl]benzoate.
| Compound Name | methyl 3-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17175247 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | methyl 3-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2ccc(S(=O)(=O)N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C20H23N3O5S/c1-22-10-12-23(13-11-22)29(26,27)18-8-6-17(7-9-18)21-19(24)15-4-3-5-16(14-15)20(25)28-2/h3-9,14H,10-13H2,1-2H3,(H,21,24) |
| InChIKey | WCDOIYSUNDOUHQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |