C11H18O7S — CID 171753796
4,11-dimethyl-9-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 171753796) has the molecular formula C11H18O7S and a molecular weight of 294.33 g/mol. Its IUPAC name is 4,11-dimethyl-9-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 4,11-dimethyl-9-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 171753796 |
| Molecular Formula | C11H18O7S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4,11-dimethyl-9-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1OC2OC3C(CS(C)(=O)=O)OC(C)OC3C2O1 |
| InChI | InChI=1S/C11H18O7S/c1-5-14-7(4-19(3,12)13)8-9(15-5)10-11(18-8)17-6(2)16-10/h5-11H,4H2,1-3H3 |
| InChIKey | YXUMBMPWTPHQRC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |