C18H18BrN3O2S — CID 171753829
N-[(R)-[4-[(2R)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]azetidine-1-carboxamide (PubChem CID 171753829) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is N-[(R)-[4-[(2R)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]azetidine-1-carboxamide.
| Compound Name | N-[(R)-[4-[(2R)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 171753829 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-[(R)-[4-[(2R)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]azetidine-1-carboxamide |
| SMILES | C#C[C@](C)(c1ccc(Br)cc1)c1csc([C@@H](O)NC(=O)N2CCC2)n1 |
| InChI | InChI=1S/C18H18BrN3O2S/c1-3-18(2,12-5-7-13(19)8-6-12)14-11-25-16(20-14)15(23)21-17(24)22-9-4-10-22/h1,5-8,11,15,23H,4,9-10H2,2H3,(H,21,24)/t15-,18-/m1/s1 |
| InChIKey | LYGOIPASMFHHBZ-CRAIPNDOSA-N |
| XLogP | 3.25 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|