C19H25BBrClFN5O2 — CID 171753969
[4-[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]piperazin-1-yl]-methylborinic acid (PubChem CID 171753969) has the molecular formula C19H25BBrClFN5O2 and a molecular weight of 500.61 g/mol. Its IUPAC name is [4-[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]piperazin-1-yl]-methylborinic acid.
| Compound Name | [4-[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 171753969 |
| Molecular Formula | C19H25BBrClFN5O2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [4-[7-bromo-6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN(c2nc(OC[C@@H]3CCCN3C)nc3c(F)c(Br)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C19H25BBrClFN5O2/c1-20(29)28-8-6-27(7-9-28)18-13-10-14(22)15(21)16(23)17(13)24-19(25-18)30-11-12-4-3-5-26(12)2/h10,12,29H,3-9,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | CBXYJPROTPLFDO-LBPRGKRZSA-N |
| XLogP | 2.89 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|