C47H30N2O2 — CID 171754399
4-[4-[5-(1,3-benzoxazol-2-yl)naphtho[2,1-b][1]benzofuran-11-yl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-N,N-diphenylaniline (PubChem CID 171754399) has the molecular formula C47H30N2O2 and a molecular weight of 662.82 g/mol. Its IUPAC name is 4-[4-[5-(1,3-benzoxazol-2-yl)naphtho[2,1-b][1]benzofuran-11-yl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-N,N-diphenylaniline.
| Compound Name | 4-[4-[5-(1,3-benzoxazol-2-yl)naphtho[2,1-b][1]benzofuran-11-yl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-N,N-diphenylaniline |
|---|---|
| PubChem CID | 171754399 |
| Molecular Formula | C47H30N2O2 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 4-[4-[5-(1,3-benzoxazol-2-yl)naphtho[2,1-b][1]benzofuran-11-yl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-N,N-diphenylaniline |
| SMILES | [2H]c1c([2H])c(-c2cccc3oc4cc(-c5nc6ccccc6o5)c5ccccc5c4c23)c([2H])c([2H])c1-c1c([2H])c([2H])c(N(c2ccccc2)c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C47H30N2O2/c1-3-12-34(13-4-1)49(35-14-5-2-6-15-35)36-28-26-32(27-29-36)31-22-24-33(25-23-31)37-18-11-21-43-45(37)46-39-17-8-7-16-38(39)40(30-44(46)50-43)47-48-41-19-9-10-20-42(41)51-47/h1-30H/i22D,23D,24D,25D,26D,27D,28D,29D |
| InChIKey | JBHAHWFAZOPISD-QBZZTLOZSA-N |
| XLogP | 13.35 |
| TPSA | 42.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |