C43H26N2O2S — CID 171755213
N-[8-(1,3-benzoxazol-2-yl)dibenzothiophen-3-yl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-2-amine (PubChem CID 171755213) has the molecular formula C43H26N2O2S and a molecular weight of 643.81 g/mol. Its IUPAC name is N-[8-(1,3-benzoxazol-2-yl)dibenzothiophen-3-yl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-2-amine.
| Compound Name | N-[8-(1,3-benzoxazol-2-yl)dibenzothiophen-3-yl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-2-amine |
|---|---|
| PubChem CID | 171755213 |
| Molecular Formula | C43H26N2O2S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | N-[8-(1,3-benzoxazol-2-yl)dibenzothiophen-3-yl]-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzofuran-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc4c(c3)sc3ccc(-c5nc6ccccc6o5)cc34)c3ccc4oc5ccccc5c4c3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C43H26N2O2S/c1-2-8-27(9-3-1)28-14-17-30(18-15-28)45(31-20-22-39-35(25-31)33-10-4-6-12-38(33)46-39)32-19-21-34-36-24-29(16-23-41(36)48-42(34)26-32)43-44-37-11-5-7-13-40(37)47-43/h1-26H/i1D,2D,3D,8D,9D,14D,15D,17D,18D |
| InChIKey | JUDYWTZXHZMMAD-FNYAXSFBSA-N |
| XLogP | 12.90 |
| TPSA | 42.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |