C80H156N4O12 — CID 171755802
[2-hydroxy-3-[4,8,11-tris[2-hydroxy-3-(8-propylundecanoyloxy)propyl]-1,4,8,11-tetrazacyclotetradec-1-yl]propyl] 8-propyltridecanoate (PubChem CID 171755802) has the molecular formula C80H156N4O12 and a molecular weight of 1366.14 g/mol. Its IUPAC name is [2-hydroxy-3-[4,8,11-tris[2-hydroxy-3-(8-propylundecanoyloxy)propyl]-1,4,8,11-tetrazacyclotetradec-1-yl]propyl] 8-propyltridecanoate.
| Compound Name | [2-hydroxy-3-[4,8,11-tris[2-hydroxy-3-(8-propylundecanoyloxy)propyl]-1,4,8,11-tetrazacyclotetradec-1-yl]propyl] 8-propyltridecanoate |
|---|---|
| PubChem CID | 171755802 |
| Molecular Formula | C80H156N4O12 |
| Molecular Weight | 1366.14 g/mol |
| Exact Mass | 1365.17 |
| IUPAC Name | [2-hydroxy-3-[4,8,11-tris[2-hydroxy-3-(8-propylundecanoyloxy)propyl]-1,4,8,11-tetrazacyclotetradec-1-yl]propyl] 8-propyltridecanoate |
| SMILES | CCCCCC(CCC)CCCCCCC(=O)OCC(O)CN1CCCN(CC(O)COC(=O)CCCCCCC(CCC)CCC)CCN(CC(O)COC(=O)CCCCCCC(CCC)CCC)CCCN(CC(O)COC(=O)CCCCCCC(CCC)CCC)CC1 |
| InChI | InChI=1S/C80H156N4O12/c1-9-17-26-44-72(43-16-8)48-30-21-25-34-52-80(92)96-68-76(88)64-84-56-36-55-82(62-74(86)66-94-78(90)50-32-23-19-28-46-70(39-12-4)40-13-5)58-57-81(61-73(85)65-93-77(89)49-31-22-18-27-45-69(37-10-2)38-11-3)53-35-54-83(59-60-84)63-75(87)67-95-79(91)51-33-24-20-29-47-71(41-14-6)42-15-7/h69-76,85-88H,9-68H2,1-8H3 |
| InChIKey | YLYLEPGZEBLALZ-UHFFFAOYSA-N |
| XLogP | 16.61 |
| TPSA | 199.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 62 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1366.14 |
| LogP ≤ 5 | 16.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|