C18H25ClO7S — CID 171755844
dipropyl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate (PubChem CID 171755844) has the molecular formula C18H25ClO7S and a molecular weight of 420.91 g/mol. Its IUPAC name is dipropyl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate.
| Compound Name | dipropyl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate |
|---|---|
| PubChem CID | 171755844 |
| Molecular Formula | C18H25ClO7S |
| Molecular Weight | 420.91 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | dipropyl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate |
| SMILES | CCCOC(=O)[C@@H](CC)[C@@H](OS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCCC |
| InChI | InChI=1S/C18H25ClO7S/c1-4-11-24-17(20)15(6-3)16(18(21)25-12-5-2)26-27(22,23)14-9-7-13(19)8-10-14/h7-10,15-16H,4-6,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | UMGFIUHTHOJVFK-JKSUJKDBSA-N |
| XLogP | 3.35 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.91 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|