About dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate
dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate (PubChem CID 171755861) has the molecular formula C18H25ClO7S
and a molecular weight of 420.91 g/mol. Its IUPAC name is dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate |
| PubChem CID | 171755861 |
| Molecular Formula | C18H25ClO7S |
| Molecular Weight | 420.91 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate |
| SMILES | CC[C@H](C(=O)OC(C)C)[C@@H](OS(=O)(=O)c1ccc(Cl)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C18H25ClO7S/c1-6-15(17(20)24-11(2)3)16(18(21)25-12(4)5)26-27(22,23)14-9-7-13(19)8-10-14/h7-12,15-16H,6H2,1-5H3/t15-,16+/m0/s1 |
| InChIKey | CPVYGVZXOGWURP-JKSUJKDBSA-N |
| XLogP | 3.34 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate?
The IUPAC name of dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate (CID 171755861) is dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate.
What is the SMILES notation for dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate?
The canonical SMILES for dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate is CC[C@H](C(=O)OC(C)C)[C@@H](OS(=O)(=O)c1ccc(Cl)cc1)C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate?
The InChIKey is CPVYGVZXOGWURP-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H25ClO7S/c1-6-15(17(20)24-11(2)3)16(18(21)25-12(4)5)26-27(22,23)14-9-7-13(19)8-10-14/h7-12,15-16H,6H2,1-5H3/t15-,16+/m0/s1.
What are the key properties of dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate?
dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate has a molecular weight of 420.91 g/mol, XLogP of 3.34, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl (2R,3S)-2-(4-chlorophenyl)sulfonyloxy-3-ethylbutanedioate is sourced from PubChem (CID 171755861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).