C21H24FN3O3 — CID 171755973
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5S)-2-(4-fluoro-3-hydroxyphenyl)-5-methylcyclohexyl]-2-oxoacetamide (PubChem CID 171755973) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5S)-2-(4-fluoro-3-hydroxyphenyl)-5-methylcyclohexyl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5S)-2-(4-fluoro-3-hydroxyphenyl)-5-methylcyclohexyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 171755973 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5S)-2-(4-fluoro-3-hydroxyphenyl)-5-methylcyclohexyl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)C2C[C@@H](C)CC[C@@H]2c2ccc(F)c(O)c2)cnc1N |
| InChI | InChI=1S/C21H24FN3O3/c1-11-3-5-15(13-4-6-17(22)18(26)9-13)16(7-11)19(27)21(28)25-14-8-12(2)20(23)24-10-14/h4,6,8-11,15-16,26H,3,5,7H2,1-2H3,(H2,23,24)(H,25,28)/t11-,15+,16?/m0/s1 |
| InChIKey | VQEIELVDUWLQGS-DNMUGYJGSA-N |
| XLogP | 3.54 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|