About 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane
5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane (PubChem CID 171756202) has the molecular formula C16H29F2N
and a molecular weight of 273.41 g/mol. Its IUPAC name is 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane |
| PubChem CID | 171756202 |
| Molecular Formula | C16H29F2N |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane |
| SMILES | CC(C)(C)C1CCCC2(CN1C(C)(C)C)CC2(F)F |
| InChI | InChI=1S/C16H29F2N/c1-13(2,3)12-8-7-9-15(10-16(15,17)18)11-19(12)14(4,5)6/h12H,7-11H2,1-6H3 |
| InChIKey | WPXJEEMRITXDNW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane?
The IUPAC name of 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane (CID 171756202) is 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane.
What is the SMILES notation for 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane?
The canonical SMILES for 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane is CC(C)(C)C1CCCC2(CN1C(C)(C)C)CC2(F)F.
What is the InChIKey of 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane?
The InChIKey is WPXJEEMRITXDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29F2N/c1-13(2,3)12-8-7-9-15(10-16(15,17)18)11-19(12)14(4,5)6/h12H,7-11H2,1-6H3.
What are the key properties of 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane?
5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane has a molecular weight of 273.41 g/mol, XLogP of 4.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-2,2-difluoro-5-azaspiro[2.6]nonane is sourced from PubChem (CID 171756202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).