C16H14BrClF3N3O4S — CID 171756268
12-bromo-11-chloro-2-(2,2-difluoroethyl)-13-fluoro-16-methylsulfonyl-5,9-dioxa-2,15,17-triazatetracyclo[8.7.1.03,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene (PubChem CID 171756268) has the molecular formula C16H14BrClF3N3O4S and a molecular weight of 516.72 g/mol. Its IUPAC name is 12-bromo-11-chloro-2-(2,2-difluoroethyl)-13-fluoro-16-methylsulfonyl-5,9-dioxa-2,15,17-triazatetracyclo[8.7.1.03,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene.
| Compound Name | 12-bromo-11-chloro-2-(2,2-difluoroethyl)-13-fluoro-16-methylsulfonyl-5,9-dioxa-2,15,17-triazatetracyclo[8.7.1.03,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene |
|---|---|
| PubChem CID | 171756268 |
| Molecular Formula | C16H14BrClF3N3O4S |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | 12-bromo-11-chloro-2-(2,2-difluoroethyl)-13-fluoro-16-methylsulfonyl-5,9-dioxa-2,15,17-triazatetracyclo[8.7.1.03,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene |
| SMILES | CS(=O)(=O)c1nc2c3c(c(Cl)c(Br)c(F)c3n1)OCC1COCC1N2CC(F)F |
| InChI | InChI=1S/C16H14BrClF3N3O4S/c1-29(25,26)16-22-13-9-14(11(18)10(17)12(13)21)28-4-6-3-27-5-7(6)24(2-8(19)20)15(9)23-16/h6-8H,2-5H2,1H3 |
| InChIKey | OEVPLRZKDWLYEJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|