C40H23N5O2 — CID 171756550
4-(4-carbazol-9-yl-6-dibenzofuran-3-yl-1,3,5-triazin-2-yl)-2-phenyl-1,3-benzoxazole (PubChem CID 171756550) has the molecular formula C40H23N5O2 and a molecular weight of 605.66 g/mol. Its IUPAC name is 4-(4-carbazol-9-yl-6-dibenzofuran-3-yl-1,3,5-triazin-2-yl)-2-phenyl-1,3-benzoxazole.
| Compound Name | 4-(4-carbazol-9-yl-6-dibenzofuran-3-yl-1,3,5-triazin-2-yl)-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 171756550 |
| Molecular Formula | C40H23N5O2 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | 4-(4-carbazol-9-yl-6-dibenzofuran-3-yl-1,3,5-triazin-2-yl)-2-phenyl-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc3c(-c4nc(-c5ccc6c(c5)oc5ccccc56)nc(-n5c6ccccc6c6ccccc65)n4)cccc3o2)cc1 |
| InChI | InChI=1S/C40H23N5O2/c1-2-11-24(12-3-1)39-41-36-30(16-10-20-34(36)47-39)38-42-37(25-21-22-29-28-15-6-9-19-33(28)46-35(29)23-25)43-40(44-38)45-31-17-7-4-13-26(31)27-14-5-8-18-32(27)45/h1-23H |
| InChIKey | AANNAJQXXNWKRR-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |