C24H23ClFN7O2S — CID 171756656
3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-[(4-methoxyphenyl)methyl]pyrazin-2-amine (PubChem CID 171756656) has the molecular formula C24H23ClFN7O2S and a molecular weight of 528.01 g/mol. Its IUPAC name is 3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-[(4-methoxyphenyl)methyl]pyrazin-2-amine.
| Compound Name | 3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-[(4-methoxyphenyl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 171756656 |
| Molecular Formula | C24H23ClFN7O2S |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 3-[(1R)-1-(7-chloro-6-fluoro-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl)ethyl]-N-[(4-methoxyphenyl)methyl]pyrazin-2-amine |
| SMILES | COc1ccc(CNc2nccnc2[C@@H](C)N2CCOc3nc(Cl)c(F)c4nc(SC)nc2c34)cc1 |
| InChI | InChI=1S/C24H23ClFN7O2S/c1-13(18-21(28-9-8-27-18)29-12-14-4-6-15(34-2)7-5-14)33-10-11-35-23-16-19(17(26)20(25)31-23)30-24(36-3)32-22(16)33/h4-9,13H,10-12H2,1-3H3,(H,28,29)/t13-/m1/s1 |
| InChIKey | FCSYZOVMPPLACY-CYBMUJFWSA-N |
| XLogP | 4.91 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|