C24H21N3O2 — CID 171756997
3-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]propan-1-ol (PubChem CID 171756997) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]propan-1-ol.
| Compound Name | 3-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 171756997 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]propan-1-ol |
| SMILES | OCCCOc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C24H21N3O2/c28-14-5-15-29-20-10-8-18(9-11-20)19-16-23(21-6-1-3-12-25-21)27-24(17-19)22-7-2-4-13-26-22/h1-4,6-13,16-17,28H,5,14-15H2 |
| InChIKey | WRJSOJQBJPUEEA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|