C63H71F3N2O3S — CID 171757259
[3,5-bis[2-[4-[5-(3,5-ditert-butylphenyl)-4-methyl-2-pyridinyl]phenyl]ethyl]phenyl] trifluoromethanesulfonate (PubChem CID 171757259) has the molecular formula C63H71F3N2O3S and a molecular weight of 993.33 g/mol. Its IUPAC name is [3,5-bis[2-[4-[5-(3,5-ditert-butylphenyl)-4-methyl-2-pyridinyl]phenyl]ethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-bis[2-[4-[5-(3,5-ditert-butylphenyl)-4-methyl-2-pyridinyl]phenyl]ethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171757259 |
| Molecular Formula | C63H71F3N2O3S |
| Molecular Weight | 993.33 g/mol |
| Exact Mass | 992.51 |
| IUPAC Name | [3,5-bis[2-[4-[5-(3,5-ditert-butylphenyl)-4-methyl-2-pyridinyl]phenyl]ethyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2ccc(CCc3cc(CCc4ccc(-c5cc(C)c(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)cn5)cc4)cc(OS(=O)(=O)C(F)(F)F)c3)cc2)ncc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C63H71F3N2O3S/c1-40-27-57(67-38-55(40)48-32-50(59(3,4)5)36-51(33-48)60(6,7)8)46-23-19-42(20-24-46)15-17-44-29-45(31-54(30-44)71-72(69,70)63(64,65)66)18-16-43-21-25-47(26-22-43)58-28-41(2)56(39-68-58)49-34-52(61(9,10)11)37-53(35-49)62(12,13)14/h19-39H,15-18H2,1-14H3 |
| InChIKey | CXCTUGKSTJAKBB-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.33 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|