C23H24BrF3N4OSi — CID 171757796
2-[[9-bromo-3-methyl-5-(2,4,6-trifluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171757796) has the molecular formula C23H24BrF3N4OSi and a molecular weight of 537.46 g/mol. Its IUPAC name is 2-[[9-bromo-3-methyl-5-(2,4,6-trifluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[9-bromo-3-methyl-5-(2,4,6-trifluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171757796 |
| Molecular Formula | C23H24BrF3N4OSi |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 2-[[9-bromo-3-methyl-5-(2,4,6-trifluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cc(F)cc1F)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C23H24BrF3N4OSi/c1-13-21-22(31(30-13)12-32-7-8-33(2,3)4)16-9-14(24)5-6-19(16)28-23(29-21)20-17(26)10-15(25)11-18(20)27/h5-6,9-11H,7-8,12H2,1-4H3,(H,28,29) |
| InChIKey | YPZZRLMOEBIAMQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|