C22H36N3O8- — CID 171758859
4-[[4,7-bis[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7-triazonan-1-yl]methyl]benzoate (PubChem CID 171758859) has the molecular formula C22H36N3O8- and a molecular weight of 470.54 g/mol. Its IUPAC name is 4-[[4,7-bis[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7-triazonan-1-yl]methyl]benzoate.
| Compound Name | 4-[[4,7-bis[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7-triazonan-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 171758859 |
| Molecular Formula | C22H36N3O8- |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[[4,7-bis[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7-triazonan-1-yl]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(CN2CCN([C@H](CO)[C@H](O)CO)CCN([C@H](CO)[C@H](O)CO)CC2)cc1 |
| InChI | InChI=1S/C22H37N3O8/c26-12-18(20(30)14-28)24-7-5-23(11-16-1-3-17(4-2-16)22(32)33)6-8-25(10-9-24)19(13-27)21(31)15-29/h1-4,18-21,26-31H,5-15H2,(H,32,33)/p-1/t18-,19-,20-,21-/m1/s1 |
| InChIKey | YIZBXKZLELRVOJ-XRXFAXGQSA-M |
| XLogP | -4.10 |
| TPSA | 171.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |