C24H19F9N4O2 — CID 171759422
2-(2,4-difluorophenyl)-1,1-difluoro-1-[3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]-3-(tetrazol-1-yl)propan-2-ol (PubChem CID 171759422) has the molecular formula C24H19F9N4O2 and a molecular weight of 566.42 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-1-[3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]-3-(tetrazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]-3-(tetrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 171759422 |
| Molecular Formula | C24H19F9N4O2 |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-[3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]-3-(tetrazol-1-yl)propan-2-ol |
| SMILES | OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)C12CC(c3ccc(OCC(F)(F)C(F)(F)F)cc3)(C1)C2 |
| InChI | InChI=1S/C24H19F9N4O2/c25-15-3-6-17(18(26)7-15)21(38,11-37-13-34-35-36-37)23(29,30)20-8-19(9-20,10-20)14-1-4-16(5-2-14)39-12-22(27,28)24(31,32)33/h1-7,13,38H,8-12H2 |
| InChIKey | KFCKTUDDPCCVQU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|