C31H31F3N4O5 — CID 171760012
tert-butyl 3-[methyl-[[4-[5-[4-(2-methylphenyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2-nitrophenyl]methyl]amino]propanoate (PubChem CID 171760012) has the molecular formula C31H31F3N4O5 and a molecular weight of 596.61 g/mol. Its IUPAC name is tert-butyl 3-[methyl-[[4-[5-[4-(2-methylphenyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2-nitrophenyl]methyl]amino]propanoate.
| Compound Name | tert-butyl 3-[methyl-[[4-[5-[4-(2-methylphenyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2-nitrophenyl]methyl]amino]propanoate |
|---|---|
| PubChem CID | 171760012 |
| Molecular Formula | C31H31F3N4O5 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | tert-butyl 3-[methyl-[[4-[5-[4-(2-methylphenyl)-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2-nitrophenyl]methyl]amino]propanoate |
| SMILES | Cc1ccccc1-c1ccc(-c2nc(-c3ccc(CN(C)CCC(=O)OC(C)(C)C)c([N+](=O)[O-])c3)no2)cc1C(F)(F)F |
| InChI | InChI=1S/C31H31F3N4O5/c1-19-8-6-7-9-23(19)24-13-12-21(16-25(24)31(32,33)34)29-35-28(36-43-29)20-10-11-22(26(17-20)38(40)41)18-37(5)15-14-27(39)42-30(2,3)4/h6-13,16-17H,14-15,18H2,1-5H3 |
| InChIKey | KXFSGYITVKNORN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|