C16H21ClN4O3 — CID 171760063
[(3aS,6aR)-5-[(6-chloropyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2S)-1,4-dioxan-2-yl]methanone (PubChem CID 171760063) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is [(3aS,6aR)-5-[(6-chloropyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2S)-1,4-dioxan-2-yl]methanone.
| Compound Name | [(3aS,6aR)-5-[(6-chloropyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2S)-1,4-dioxan-2-yl]methanone |
|---|---|
| PubChem CID | 171760063 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(3aS,6aR)-5-[(6-chloropyridazin-3-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[(2S)-1,4-dioxan-2-yl]methanone |
| SMILES | O=C([C@@H]1COCCO1)N1C[C@H]2CC(Nc3ccc(Cl)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C16H21ClN4O3/c17-14-1-2-15(20-19-14)18-12-5-10-7-21(8-11(10)6-12)16(22)13-9-23-3-4-24-13/h1-2,10-13H,3-9H2,(H,18,20)/t10-,11+,12?,13-/m0/s1 |
| InChIKey | REILLXIQURKUKX-HNGCFSAESA-N |
| XLogP | 1.19 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |