C28H22N4O4 — CID 17176013
N-(4-anilinophenyl)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 17176013) has the molecular formula C28H22N4O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 17176013 |
| Molecular Formula | C28H22N4O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-(4-anilinophenyl)-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N4O4/c33-27(18-13-20-7-6-10-24(19-20)32(35)36)31-26-12-5-4-11-25(26)28(34)30-23-16-14-22(15-17-23)29-21-8-2-1-3-9-21/h1-19,29H,(H,30,34)(H,31,33)/b18-13+ |
| InChIKey | PIIXXFFGVZJQSI-QGOAFFKASA-N |
| XLogP | 6.24 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|