C24H23F3N4O2 — CID 171761399
[(1S,9S)-6-[2-(3-methylimidazol-4-yl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 171761399) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is [(1S,9S)-6-[2-(3-methylimidazol-4-yl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,9S)-6-[2-(3-methylimidazol-4-yl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 171761399 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [(1S,9S)-6-[2-(3-methylimidazol-4-yl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | Cn1cncc1C#Cc1cncc2c1O[C@H]1C[C@@H]2N(C(=O)C23CCC(C(F)(F)F)(CC2)C3)C1 |
| InChI | InChI=1S/C24H23F3N4O2/c1-30-14-29-10-16(30)3-2-15-9-28-11-18-19-8-17(33-20(15)18)12-31(19)21(32)22-4-6-23(13-22,7-5-22)24(25,26)27/h9-11,14,17,19H,4-8,12-13H2,1H3/t17-,19-,22?,23?/m0/s1 |
| InChIKey | PSKSLZGKANFVFD-YILSLVNCSA-N |
| XLogP | 3.76 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|