C22H28F2N2O2 — CID 171761401
1-[(1S,9S)-6-(5,5-dimethylhex-1-ynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-3,3-difluoro-2,2-dimethylpropan-1-one (PubChem CID 171761401) has the molecular formula C22H28F2N2O2 and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[(1S,9S)-6-(5,5-dimethylhex-1-ynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-3,3-difluoro-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1S,9S)-6-(5,5-dimethylhex-1-ynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-3,3-difluoro-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 171761401 |
| Molecular Formula | C22H28F2N2O2 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[(1S,9S)-6-(5,5-dimethylhex-1-ynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-3,3-difluoro-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)CCC#Cc1cncc2c1O[C@H]1C[C@@H]2N(C(=O)C(C)(C)C(F)F)C1 |
| InChI | InChI=1S/C22H28F2N2O2/c1-21(2,3)9-7-6-8-14-11-25-12-16-17-10-15(28-18(14)16)13-26(17)20(27)22(4,5)19(23)24/h11-12,15,17,19H,7,9-10,13H2,1-5H3/t15-,17-/m0/s1 |
| InChIKey | XNBBBCVDYFXCPL-RDJZCZTQSA-N |
| XLogP | 4.59 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|