C20H18F2N4O2 — CID 171761428
3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyrazin-2-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one (PubChem CID 171761428) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyrazin-2-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one.
| Compound Name | 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyrazin-2-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 171761428 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyrazin-2-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one |
| SMILES | CC(C)(C(=O)N1C[C@@H]2C[C@H]1c1cncc(C#Cc3cnccn3)c1O2)C(F)F |
| InChI | InChI=1S/C20H18F2N4O2/c1-20(2,18(21)22)19(27)26-11-14-7-16(26)15-10-24-8-12(17(15)28-14)3-4-13-9-23-5-6-25-13/h5-6,8-10,14,16,18H,7,11H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | RVSJBDBRNXLUOR-HOCLYGCPSA-N |
| XLogP | 2.60 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|