C16H17F2N3O2 — CID 171761594
(1S,9S)-11-(3,3-difluoro-2,2-dimethylbutanoyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile (PubChem CID 171761594) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is (1S,9S)-11-(3,3-difluoro-2,2-dimethylbutanoyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile.
| Compound Name | (1S,9S)-11-(3,3-difluoro-2,2-dimethylbutanoyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile |
|---|---|
| PubChem CID | 171761594 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (1S,9S)-11-(3,3-difluoro-2,2-dimethylbutanoyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-6-carbonitrile |
| SMILES | CC(F)(F)C(C)(C)C(=O)N1C[C@@H]2C[C@H]1c1cncc(C#N)c1O2 |
| InChI | InChI=1S/C16H17F2N3O2/c1-15(2,16(3,17)18)14(22)21-8-10-4-12(21)11-7-20-6-9(5-19)13(11)23-10/h6-7,10,12H,4,8H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | HKTNOONHLRYSPG-JQWIXIFHSA-N |
| XLogP | 2.67 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |