C23H24F2N2O3 — CID 171761620
(4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-[3-(3-fluorooxetan-3-yl)prop-1-ynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone (PubChem CID 171761620) has the molecular formula C23H24F2N2O3 and a molecular weight of 414.45 g/mol. Its IUPAC name is (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-[3-(3-fluorooxetan-3-yl)prop-1-ynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone.
| Compound Name | (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-[3-(3-fluorooxetan-3-yl)prop-1-ynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone |
|---|---|
| PubChem CID | 171761620 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-[3-(3-fluorooxetan-3-yl)prop-1-ynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(C#CCC3(F)COC3)c1O2)C12CCC(F)(CC1)C2 |
| InChI | InChI=1S/C23H24F2N2O3/c24-22-6-4-21(12-22,5-7-22)20(28)27-11-16-8-18(27)17-10-26-9-15(19(17)30-16)2-1-3-23(25)13-29-14-23/h9-10,16,18H,3-8,11-14H2/t16-,18-,21?,22?/m0/s1 |
| InChIKey | RCCUVOAWIKPICC-HDDMWFRZSA-N |
| XLogP | 3.27 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|