C17H15Cl2FN4O — CID 171761683
(1R,9S)-N'-(3,4-dichlorophenyl)-6-fluoro-N-hydroxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide (PubChem CID 171761683) has the molecular formula C17H15Cl2FN4O and a molecular weight of 381.24 g/mol. Its IUPAC name is (1R,9S)-N'-(3,4-dichlorophenyl)-6-fluoro-N-hydroxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide.
| Compound Name | (1R,9S)-N'-(3,4-dichlorophenyl)-6-fluoro-N-hydroxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide |
|---|---|
| PubChem CID | 171761683 |
| Molecular Formula | C17H15Cl2FN4O |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (1R,9S)-N'-(3,4-dichlorophenyl)-6-fluoro-N-hydroxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide |
| SMILES | ON/C(=N\c1ccc(Cl)c(Cl)c1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C17H15Cl2FN4O/c18-13-3-1-9(7-14(13)19)22-17(23-25)24-10-2-4-15(24)11-5-6-21-16(20)12(11)8-10/h1,3,5-7,10,15,25H,2,4,8H2,(H,22,23)/t10-,15+/m0/s1 |
| InChIKey | CYIHHJQVMXYIEB-ZUZCIYMTSA-N |
| XLogP | 4.26 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|