C53H33N3OS — CID 171762113
2-dibenzofuran-3-yl-4-[1-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]phenanthren-4-yl]-6-phenyl-1,2-dihydro-1,3,5-triazine (PubChem CID 171762113) has the molecular formula C53H33N3OS and a molecular weight of 764.96 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-[1-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]phenanthren-4-yl]-6-phenyl-1,2-dihydro-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-[1-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]phenanthren-4-yl]-6-phenyl-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 171762113 |
| Molecular Formula | C53H33N3OS |
| Molecular Weight | 764.96 g/mol |
| Exact Mass | 764.27 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-[1-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]phenanthren-4-yl]-6-phenyl-1,2-dihydro-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2sc2c(-c4ccc(C5=NC(c6ccc7c(c6)oc6ccccc67)NC(c6ccccc6)=N5)c5c4ccc4ccccc45)cccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C53H33N3OS/c1-3-13-32(14-4-1)37-20-11-22-43-44-23-12-21-42(50(44)58-49(37)43)38-29-30-45(48-36-18-8-7-15-33(36)25-28-41(38)48)53-55-51(34-16-5-2-6-17-34)54-52(56-53)35-26-27-40-39-19-9-10-24-46(39)57-47(40)31-35/h1-31,52H,(H,54,55,56)/i1D,3D,4D,13D,14D |
| InChIKey | HFHOMZBRBWGCQO-CULCNESPSA-N |
| XLogP | 14.09 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.96 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|