C35H30F3N3O3 — CID 171762123
5-butoxy-1-(2,3-difluoro-10H-indeno[1,2-a]inden-4b-yl)-3-[2-(4-fluorophenyl)ethyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 171762123) has the molecular formula C35H30F3N3O3 and a molecular weight of 597.64 g/mol. Its IUPAC name is 5-butoxy-1-(2,3-difluoro-10H-indeno[1,2-a]inden-4b-yl)-3-[2-(4-fluorophenyl)ethyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 5-butoxy-1-(2,3-difluoro-10H-indeno[1,2-a]inden-4b-yl)-3-[2-(4-fluorophenyl)ethyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 171762123 |
| Molecular Formula | C35H30F3N3O3 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 5-butoxy-1-(2,3-difluoro-10H-indeno[1,2-a]inden-4b-yl)-3-[2-(4-fluorophenyl)ethyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCCCOc1c2n(ccc1=O)N(C13C(=Cc4ccccc41)Cc1cc(F)c(F)cc13)CN(CCc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C35H30F3N3O3/c1-2-3-16-44-33-31(42)13-15-40-32(33)34(43)39(14-12-22-8-10-26(36)11-9-22)21-41(40)35-25(17-23-6-4-5-7-27(23)35)18-24-19-29(37)30(38)20-28(24)35/h4-11,13,15,17,19-20H,2-3,12,14,16,18,21H2,1H3 |
| InChIKey | OCFPPNFRYRCIMM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|