About 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate
2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate (PubChem CID 171762692) has the molecular formula C11H11FO4S
and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate |
| PubChem CID | 171762692 |
| Molecular Formula | C11H11FO4S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11FO4S/c1-9(12)11(13)16-7-8-17(14,15)10-5-3-2-4-6-10/h2-6H,1,7-8H2 |
| InChIKey | UQXBPGNXFJQFEA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate?
The IUPAC name of 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate (CID 171762692) is 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate.
What is the SMILES notation for 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate?
The canonical SMILES for 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate is C=C(F)C(=O)OCCS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate?
The InChIKey is UQXBPGNXFJQFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO4S/c1-9(12)11(13)16-7-8-17(14,15)10-5-3-2-4-6-10/h2-6H,1,7-8H2.
What are the key properties of 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate?
2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate has a molecular weight of 258.27 g/mol, XLogP of 1.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)ethyl 2-fluoroprop-2-enoate is sourced from PubChem (CID 171762692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).