About [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol
[3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol (PubChem CID 171763504) has the molecular formula C8H11ClN4O2
and a molecular weight of 230.65 g/mol. Its IUPAC name is [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol |
| PubChem CID | 171763504 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol |
| SMILES | Cc1nc(NC2(CO)COC2)nnc1Cl |
| InChI | InChI=1S/C8H11ClN4O2/c1-5-6(9)12-13-7(10-5)11-8(2-14)3-15-4-8/h14H,2-4H2,1H3,(H,10,11,13) |
| InChIKey | HOFQLBKQESPQBE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol?
The IUPAC name of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol (CID 171763504) is [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol.
What is the SMILES notation for [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol?
The canonical SMILES for [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol is Cc1nc(NC2(CO)COC2)nnc1Cl.
What is the InChIKey of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol?
The InChIKey is HOFQLBKQESPQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN4O2/c1-5-6(9)12-13-7(10-5)11-8(2-14)3-15-4-8/h14H,2-4H2,1H3,(H,10,11,13).
What are the key properties of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol?
[3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol has a molecular weight of 230.65 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]oxetan-3-yl]methanol is sourced from PubChem (CID 171763504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).