About 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol
3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol (PubChem CID 171763594) has the molecular formula C7H11ClN4O
and a molecular weight of 202.64 g/mol. Its IUPAC name is 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol |
| PubChem CID | 171763594 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol |
| SMILES | Cc1nc(NCCCO)nnc1Cl |
| InChI | InChI=1S/C7H11ClN4O/c1-5-6(8)11-12-7(10-5)9-3-2-4-13/h13H,2-4H2,1H3,(H,9,10,12) |
| InChIKey | KNRHBBIWWXYOMC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol?
The IUPAC name of 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol (CID 171763594) is 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol is Cc1nc(NCCCO)nnc1Cl.
What is the InChIKey of 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol?
The InChIKey is KNRHBBIWWXYOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN4O/c1-5-6(8)11-12-7(10-5)9-3-2-4-13/h13H,2-4H2,1H3,(H,9,10,12).
What are the key properties of 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol?
3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol has a molecular weight of 202.64 g/mol, XLogP of 0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]propan-1-ol is sourced from PubChem (CID 171763594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).