About 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol
1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol (PubChem CID 171763620) has the molecular formula C9H13ClN4O
and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol |
| PubChem CID | 171763620 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol |
| SMILES | Cc1nc(NCC2(O)CCC2)nnc1Cl |
| InChI | InChI=1S/C9H13ClN4O/c1-6-7(10)13-14-8(12-6)11-5-9(15)3-2-4-9/h15H,2-5H2,1H3,(H,11,12,14) |
| InChIKey | PTANXUDYHIPFSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol?
The IUPAC name of 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol (CID 171763620) is 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol.
What is the SMILES notation for 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol?
The canonical SMILES for 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol is Cc1nc(NCC2(O)CCC2)nnc1Cl.
What is the InChIKey of 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol?
The InChIKey is PTANXUDYHIPFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN4O/c1-6-7(10)13-14-8(12-6)11-5-9(15)3-2-4-9/h15H,2-5H2,1H3,(H,11,12,14).
What are the key properties of 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol?
1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol has a molecular weight of 228.68 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]methyl]cyclobutan-1-ol is sourced from PubChem (CID 171763620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).