About [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol
[3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol (PubChem CID 171763672) has the molecular formula C10H13ClN4O
and a molecular weight of 240.69 g/mol. Its IUPAC name is [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol.
Molecular Properties
| Compound Name | [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol |
| PubChem CID | 171763672 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol |
| SMILES | Cc1nc(NC23CC(CO)(C2)C3)nnc1Cl |
| InChI | InChI=1S/C10H13ClN4O/c1-6-7(11)14-15-8(12-6)13-10-2-9(3-10,4-10)5-16/h16H,2-5H2,1H3,(H,12,13,15) |
| InChIKey | JZAHJZVSPRMODH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol?
The IUPAC name of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol (CID 171763672) is [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol.
What is the SMILES notation for [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol?
The canonical SMILES for [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol is Cc1nc(NC23CC(CO)(C2)C3)nnc1Cl.
What is the InChIKey of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol?
The InChIKey is JZAHJZVSPRMODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4O/c1-6-7(11)14-15-8(12-6)13-10-2-9(3-10,4-10)5-16/h16H,2-5H2,1H3,(H,12,13,15).
What are the key properties of [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol?
[3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol has a molecular weight of 240.69 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(6-chloro-5-methyl-1,2,4-triazin-3-yl)amino]-1-bicyclo[1.1.1]pentanyl]methanol is sourced from PubChem (CID 171763672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).