C29H29FN4O5S2 — CID 171764122
5-[4-[[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-methylamino]methyl]-2-fluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 171764122) has the molecular formula C29H29FN4O5S2 and a molecular weight of 596.71 g/mol. Its IUPAC name is 5-[4-[[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-methylamino]methyl]-2-fluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[4-[[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-methylamino]methyl]-2-fluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 171764122 |
| Molecular Formula | C29H29FN4O5S2 |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 5-[4-[[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-methylamino]methyl]-2-fluoro-6-[(4-methoxyphenyl)methoxy]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | COc1ccc(COc2cc(CN(C)c3nc(-c4ccc(C)cc4C)cs3)cc(F)c2N2CC(=O)NS2(=O)=O)cc1 |
| InChI | InChI=1S/C29H29FN4O5S2/c1-18-5-10-23(19(2)11-18)25-17-40-29(31-25)33(3)14-21-12-24(30)28(34-15-27(35)32-41(34,36)37)26(13-21)39-16-20-6-8-22(38-4)9-7-20/h5-13,17H,14-16H2,1-4H3,(H,32,35) |
| InChIKey | IXXOFVRBAXBXMD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |