C38H48GeIrNO2- — CID 171764463
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[4-[2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]germane (PubChem CID 171764463) has the molecular formula C38H48GeIrNO2- and a molecular weight of 815.63 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[4-[2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]germane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[4-[2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]germane |
|---|---|
| PubChem CID | 171764463 |
| Molecular Formula | C38H48GeIrNO2- |
| Molecular Weight | 815.63 g/mol |
| Exact Mass | 817.25 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;trimethyl-[4-[2-(4-methyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]phenyl]germane |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(-c2cc(-c3ccc([Ge](C)(C)C)cc3)ccn2)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C25H24GeN.C13H24O2.Ir/c1-18-15-22(16-21-7-5-6-8-24(18)21)25-17-20(13-14-27-25)19-9-11-23(12-10-19)26(2,3)4;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-15,17H,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | LKJFCJCUSUZOAC-DZTQYQPZSA-N |
| XLogP | 10.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.63 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|