C36H26N4 — CID 171766407
5-[3-(2,6-dimethyl-4-pyridinyl)-5-(3-pyridin-2-ylphenyl)phenyl]-4,7-phenanthroline (PubChem CID 171766407) has the molecular formula C36H26N4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 5-[3-(2,6-dimethyl-4-pyridinyl)-5-(3-pyridin-2-ylphenyl)phenyl]-4,7-phenanthroline.
| Compound Name | 5-[3-(2,6-dimethyl-4-pyridinyl)-5-(3-pyridin-2-ylphenyl)phenyl]-4,7-phenanthroline |
|---|---|
| PubChem CID | 171766407 |
| Molecular Formula | C36H26N4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 5-[3-(2,6-dimethyl-4-pyridinyl)-5-(3-pyridin-2-ylphenyl)phenyl]-4,7-phenanthroline |
| SMILES | Cc1cc(-c2cc(-c3cccc(-c4ccccn4)c3)cc(-c3cc4ncccc4c4cccnc34)c2)cc(C)n1 |
| InChI | InChI=1S/C36H26N4/c1-23-16-27(17-24(2)40-23)29-19-28(25-8-5-9-26(18-25)34-12-3-4-13-37-34)20-30(21-29)33-22-35-31(10-6-14-38-35)32-11-7-15-39-36(32)33/h3-22H,1-2H3 |
| InChIKey | OFNJYJLGLIMBCV-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|