C34H43F3N6O2 — CID 171767517
N-[[4-[6-[4-(2-azaspiro[4.5]decan-8-yl)piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide (PubChem CID 171767517) has the molecular formula C34H43F3N6O2 and a molecular weight of 624.75 g/mol. Its IUPAC name is N-[[4-[6-[4-(2-azaspiro[4.5]decan-8-yl)piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide.
| Compound Name | N-[[4-[6-[4-(2-azaspiro[4.5]decan-8-yl)piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 171767517 |
| Molecular Formula | C34H43F3N6O2 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | N-[[4-[6-[4-(2-azaspiro[4.5]decan-8-yl)piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
| SMILES | O=C(NCC1CCC(n2cc3ccc(N4CCN(C5CCC6(CCNC6)CC5)CC4)cc3n2)CC1)c1cc(F)c(O)c(F)c1F |
| InChI | InChI=1S/C34H43F3N6O2/c35-28-18-27(30(36)31(37)32(28)44)33(45)39-19-22-1-4-25(5-2-22)43-20-23-3-6-26(17-29(23)40-43)42-15-13-41(14-16-42)24-7-9-34(10-8-24)11-12-38-21-34/h3,6,17-18,20,22,24-25,38,44H,1-2,4-5,7-16,19,21H2,(H,39,45) |
| InChIKey | HVCKTFKFHXOSET-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|