C15H15N3O3S — CID 17176754
2-amino-5-[3-hydroxy-1-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-1,3-thiazol-4-one (PubChem CID 17176754) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-amino-5-[3-hydroxy-1-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[3-hydroxy-1-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 17176754 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-amino-5-[3-hydroxy-1-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-1,3-thiazol-4-one |
| SMILES | C=C(C)CN1C(=O)C(O)(C2SC(N)=NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H15N3O3S/c1-8(2)7-18-10-6-4-3-5-9(10)15(21,13(18)20)11-12(19)17-14(16)22-11/h3-6,11,21H,1,7H2,2H3,(H2,16,17,19) |
| InChIKey | YLTTUKFHJIYEGS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|