C16H26N2 — CID 171767542
2,6-ditert-butyl-3,4-dihydro-1H-2,7-naphthyridine (PubChem CID 171767542) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-3,4-dihydro-1H-2,7-naphthyridine.
| Compound Name | 2,6-ditert-butyl-3,4-dihydro-1H-2,7-naphthyridine |
|---|---|
| PubChem CID | 171767542 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2,6-ditert-butyl-3,4-dihydro-1H-2,7-naphthyridine |
| SMILES | CC(C)(C)c1cc2c(cn1)CN(C(C)(C)C)CC2 |
| InChI | InChI=1S/C16H26N2/c1-15(2,3)14-9-12-7-8-18(16(4,5)6)11-13(12)10-17-14/h9-10H,7-8,11H2,1-6H3 |
| InChIKey | KOIDSEBCXFZYKY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |