C16H28F2N2O — CID 171767649
2,9-ditert-butyl-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 171767649) has the molecular formula C16H28F2N2O and a molecular weight of 302.41 g/mol. Its IUPAC name is 2,9-ditert-butyl-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 2,9-ditert-butyl-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 171767649 |
| Molecular Formula | C16H28F2N2O |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2,9-ditert-butyl-7,7-difluoro-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | CC(C)(C)N1CC(F)(F)CC2(CCN(C(C)(C)C)C2=O)C1 |
| InChI | InChI=1S/C16H28F2N2O/c1-13(2,3)19-10-15(9-16(17,18)11-19)7-8-20(12(15)21)14(4,5)6/h7-11H2,1-6H3 |
| InChIKey | UHFIFTBSJBMEQY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |