C34H45N3O8 — CID 171768249
4-O-[6-[2-(benzotriazol-2-yl)-4-methylphenoxy]-6-oxohexyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate (PubChem CID 171768249) has the molecular formula C34H45N3O8 and a molecular weight of 623.75 g/mol. Its IUPAC name is 4-O-[6-[2-(benzotriazol-2-yl)-4-methylphenoxy]-6-oxohexyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate.
| Compound Name | 4-O-[6-[2-(benzotriazol-2-yl)-4-methylphenoxy]-6-oxohexyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 171768249 |
| Molecular Formula | C34H45N3O8 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | 4-O-[6-[2-(benzotriazol-2-yl)-4-methylphenoxy]-6-oxohexyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
| SMILES | Cc1ccc(OC(=O)CCCCCOC(=O)C(C)CC(C(=O)OC(C)C)C(C)C(=O)OC(C)C)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C34H45N3O8/c1-21(2)43-33(40)25(7)26(34(41)44-22(3)4)20-24(6)32(39)42-18-12-8-9-15-31(38)45-30-17-16-23(5)19-29(30)37-35-27-13-10-11-14-28(27)36-37/h10-11,13-14,16-17,19,21-22,24-26H,8-9,12,15,18,20H2,1-7H3 |
| InChIKey | UDUJZSYLRGLWEO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 135.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|