C12H6F4O3 — CID 171771382
5-(2,3,5,6-tetrafluorophenoxy)benzene-1,3-diol (PubChem CID 171771382) has the molecular formula C12H6F4O3 and a molecular weight of 274.17 g/mol. Its IUPAC name is 5-(2,3,5,6-tetrafluorophenoxy)benzene-1,3-diol.
| Compound Name | 5-(2,3,5,6-tetrafluorophenoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 171771382 |
| Molecular Formula | C12H6F4O3 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 5-(2,3,5,6-tetrafluorophenoxy)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(Oc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C12H6F4O3/c13-8-4-9(14)11(16)12(10(8)15)19-7-2-5(17)1-6(18)3-7/h1-4,17-18H |
| InChIKey | ZLQOCLBOBYLYES-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|