C19H20FN5O4S — CID 171771964
7-fluoro-2-(oxan-2-ylmethyl)-N-(2-sulfamoyl-4-pyridinyl)indazole-3-carboxamide (PubChem CID 171771964) has the molecular formula C19H20FN5O4S and a molecular weight of 433.47 g/mol. Its IUPAC name is 7-fluoro-2-(oxan-2-ylmethyl)-N-(2-sulfamoyl-4-pyridinyl)indazole-3-carboxamide.
| Compound Name | 7-fluoro-2-(oxan-2-ylmethyl)-N-(2-sulfamoyl-4-pyridinyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 171771964 |
| Molecular Formula | C19H20FN5O4S |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 7-fluoro-2-(oxan-2-ylmethyl)-N-(2-sulfamoyl-4-pyridinyl)indazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)c2c3cccc(F)c3nn2CC2CCCCO2)ccn1 |
| InChI | InChI=1S/C19H20FN5O4S/c20-15-6-3-5-14-17(15)24-25(11-13-4-1-2-9-29-13)18(14)19(26)23-12-7-8-22-16(10-12)30(21,27)28/h3,5-8,10,13H,1-2,4,9,11H2,(H2,21,27,28)(H,22,23,26) |
| InChIKey | ZRKIYWBGMWLCGG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |