C21H23FN4O3S — CID 171772051
2-(cyclohexylmethyl)-6-fluoro-N-(3-sulfamoylphenyl)indazole-3-carboxamide (PubChem CID 171772051) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-6-fluoro-N-(3-sulfamoylphenyl)indazole-3-carboxamide.
| Compound Name | 2-(cyclohexylmethyl)-6-fluoro-N-(3-sulfamoylphenyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 171772051 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-(cyclohexylmethyl)-6-fluoro-N-(3-sulfamoylphenyl)indazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2c3ccc(F)cc3nn2CC2CCCCC2)c1 |
| InChI | InChI=1S/C21H23FN4O3S/c22-15-9-10-18-19(11-15)25-26(13-14-5-2-1-3-6-14)20(18)21(27)24-16-7-4-8-17(12-16)30(23,28)29/h4,7-12,14H,1-3,5-6,13H2,(H,24,27)(H2,23,28,29) |
| InChIKey | FEHYBCJFLUOVIP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |